C15H15NO3 — CID 118211209
6-methoxy-2-propan-2-ylbenzo[g][1,3]benzoxazol-5-ol (PubChem CID 118211209) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 6-methoxy-2-propan-2-ylbenzo[g][1,3]benzoxazol-5-ol.
| Compound Name | 6-methoxy-2-propan-2-ylbenzo[g][1,3]benzoxazol-5-ol |
|---|---|
| PubChem CID | 118211209 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 6-methoxy-2-propan-2-ylbenzo[g][1,3]benzoxazol-5-ol |
| SMILES | COc1cccc2c1c(O)cc1nc(C(C)C)oc12 |
| InChI | InChI=1S/C15H15NO3/c1-8(2)15-16-10-7-11(17)13-9(14(10)19-15)5-4-6-12(13)18-3/h4-8,17H,1-3H3 |
| InChIKey | OBGDXPYYMSMSTN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |