C13H13N3O3 — CID 118211270
[1-(3-nitrophenyl)cyclohexa-2,4-dien-1-yl]urea (PubChem CID 118211270) has the molecular formula C13H13N3O3 and a molecular weight of 259.27 g/mol. Its IUPAC name is [1-(3-nitrophenyl)cyclohexa-2,4-dien-1-yl]urea.
| Compound Name | [1-(3-nitrophenyl)cyclohexa-2,4-dien-1-yl]urea |
|---|---|
| PubChem CID | 118211270 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | [1-(3-nitrophenyl)cyclohexa-2,4-dien-1-yl]urea |
| SMILES | NC(=O)NC1(c2cccc([N+](=O)[O-])c2)C=CC=CC1 |
| InChI | InChI=1S/C13H13N3O3/c14-12(17)15-13(7-2-1-3-8-13)10-5-4-6-11(9-10)16(18)19/h1-7,9H,8H2,(H3,14,15,17) |
| InChIKey | BIKFGHKRHBRTET-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|