About 2-ethyl-2,6-dimethyl-4-phenylchromene
2-ethyl-2,6-dimethyl-4-phenylchromene (PubChem CID 11821502) has the molecular formula C19H20O
and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-ethyl-2,6-dimethyl-4-phenylchromene.
Molecular Properties
| Compound Name | 2-ethyl-2,6-dimethyl-4-phenylchromene |
| PubChem CID | 11821502 |
| Molecular Formula | C19H20O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-ethyl-2,6-dimethyl-4-phenylchromene |
| SMILES | CCC1(C)C=C(c2ccccc2)c2cc(C)ccc2O1 |
| InChI | InChI=1S/C19H20O/c1-4-19(3)13-17(15-8-6-5-7-9-15)16-12-14(2)10-11-18(16)20-19/h5-13H,4H2,1-3H3 |
| InChIKey | GYKOPDOFWBTSCA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-2,6-dimethyl-4-phenylchromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2,6-dimethyl-4-phenylchromene?
The IUPAC name of 2-ethyl-2,6-dimethyl-4-phenylchromene (CID 11821502) is 2-ethyl-2,6-dimethyl-4-phenylchromene.
What is the SMILES notation for 2-ethyl-2,6-dimethyl-4-phenylchromene?
The canonical SMILES for 2-ethyl-2,6-dimethyl-4-phenylchromene is CCC1(C)C=C(c2ccccc2)c2cc(C)ccc2O1.
What is the InChIKey of 2-ethyl-2,6-dimethyl-4-phenylchromene?
The InChIKey is GYKOPDOFWBTSCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O/c1-4-19(3)13-17(15-8-6-5-7-9-15)16-12-14(2)10-11-18(16)20-19/h5-13H,4H2,1-3H3.
What are the key properties of 2-ethyl-2,6-dimethyl-4-phenylchromene?
2-ethyl-2,6-dimethyl-4-phenylchromene has a molecular weight of 264.37 g/mol, XLogP of 4.99, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2,6-dimethyl-4-phenylchromene is sourced from PubChem (CID 11821502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).