C16H32N2 — CID 118221169
3-propyl-1,11-diazabicyclo[9.3.1]pentadecane (PubChem CID 118221169) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 3-propyl-1,11-diazabicyclo[9.3.1]pentadecane.
| Compound Name | 3-propyl-1,11-diazabicyclo[9.3.1]pentadecane |
|---|---|
| PubChem CID | 118221169 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 3-propyl-1,11-diazabicyclo[9.3.1]pentadecane |
| SMILES | CCCC1CCCCCCCN2CCCN(C1)C2 |
| InChI | InChI=1S/C16H32N2/c1-2-9-16-10-6-4-3-5-7-11-17-12-8-13-18(14-16)15-17/h16H,2-15H2,1H3 |
| InChIKey | QPRIBXNFIGHKOF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |