C16H21N7O2 — CID 118223778
tert-butyl 3-(2-azidoimidazo[4,5-c]pyridin-3-yl)piperidine-1-carboxylate (PubChem CID 118223778) has the molecular formula C16H21N7O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is tert-butyl 3-(2-azidoimidazo[4,5-c]pyridin-3-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-azidoimidazo[4,5-c]pyridin-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118223778 |
| Molecular Formula | C16H21N7O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | tert-butyl 3-(2-azidoimidazo[4,5-c]pyridin-3-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(n2c(N=[N+]=[N-])nc3ccncc32)C1 |
| InChI | InChI=1S/C16H21N7O2/c1-16(2,3)25-15(24)22-8-4-5-11(10-22)23-13-9-18-7-6-12(13)19-14(23)20-21-17/h6-7,9,11H,4-5,8,10H2,1-3H3 |
| InChIKey | AYKUFHHBQKAQCC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 109.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|