About 2-[6-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]hexoxy]oxane
2-[6-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]hexoxy]oxane (PubChem CID 11822465) has the molecular formula C19H32O2
and a molecular weight of 292.50 g/mol. Its IUPAC name is 2-[6-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]hexoxy]oxane.
Molecular Properties
| Compound Name | 2-[6-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]hexoxy]oxane |
| PubChem CID | 11822465 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 2-[6-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]hexoxy]oxane |
| SMILES | C1CCOC(C1)OCCCCCCC/2C/C=C\CC/C=C2 |
| InChI | InChI=1S/C19H32O2/c1-2-6-12-18(13-7-3-1)14-8-4-5-10-16-20-19-15-9-11-17-21-19/h2,6-7,13,18-19H,1,3-5,8-12,14-17H2/b6-2-,13-7- |
| InChIKey | IPMGTUAUSDRTEY-NAGSDWBGSA-N |
| XLogP | 5.60 |
| TPSA | 18.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | 309 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]hexoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]hexoxy]oxane?
The IUPAC name of 2-[6-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]hexoxy]oxane (CID 11822465) is 2-[6-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]hexoxy]oxane.
What is the SMILES notation for 2-[6-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]hexoxy]oxane?
The canonical SMILES for 2-[6-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]hexoxy]oxane is C1CCOC(C1)OCCCCCCC/2C/C=C\CC/C=C2.
What is the InChIKey of 2-[6-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]hexoxy]oxane?
The InChIKey is IPMGTUAUSDRTEY-NAGSDWBGSA-N. The full InChI is InChI=1S/C19H32O2/c1-2-6-12-18(13-7-3-1)14-8-4-5-10-16-20-19-15-9-11-17-21-19/h2,6-7,13,18-19H,1,3-5,8-12,14-17H2/b6-2-,13-7-.
What are the key properties of 2-[6-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]hexoxy]oxane?
2-[6-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]hexoxy]oxane has a molecular weight of 292.50 g/mol, XLogP of 5.60, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]hexoxy]oxane is sourced from PubChem (CID 11822465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).