C19H32O2 — CID 11822465
2-[6-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]hexoxy]oxane (PubChem CID 11822465) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 2-[6-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]hexoxy]oxane.
| Compound Name | 2-[6-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]hexoxy]oxane |
|---|---|
| PubChem CID | 11822465 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 2-[6-[(2Z,6Z)-cycloocta-2,6-dien-1-yl]hexoxy]oxane |
| SMILES | C1=C\CC(CCCCCCOC2CCCCO2)/C=C\CC/1 |
| InChI | InChI=1S/C19H32O2/c1-2-6-12-18(13-7-3-1)14-8-4-5-10-16-20-19-15-9-11-17-21-19/h2,6-7,13,18-19H,1,3-5,8-12,14-17H2/b6-2-,13-7- |
| InChIKey | IPMGTUAUSDRTEY-NAGSDWBGSA-N |
| XLogP | 5.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|