C10H20N2O4 — CID 118227724
(5R,6R,7S)-2-(dimethylamino)-7-(hydroxymethyl)-4-methyl-5,6,7,8-tetrahydro-4H-1,3-oxazocine-5,6-diol (PubChem CID 118227724) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is (5R,6R,7S)-2-(dimethylamino)-7-(hydroxymethyl)-4-methyl-5,6,7,8-tetrahydro-4H-1,3-oxazocine-5,6-diol.
| Compound Name | (5R,6R,7S)-2-(dimethylamino)-7-(hydroxymethyl)-4-methyl-5,6,7,8-tetrahydro-4H-1,3-oxazocine-5,6-diol |
|---|---|
| PubChem CID | 118227724 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | (5R,6R,7S)-2-(dimethylamino)-7-(hydroxymethyl)-4-methyl-5,6,7,8-tetrahydro-4H-1,3-oxazocine-5,6-diol |
| SMILES | CC1/N=C(/N(C)C)OC[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H20N2O4/c1-6-8(14)9(15)7(4-13)5-16-10(11-6)12(2)3/h6-9,13-15H,4-5H2,1-3H3/b11-10-/t6?,7-,8+,9+/m0/s1 |
| InChIKey | PLKICSFGKGBYLN-ZYZJSINYSA-N |
| XLogP | -1.35 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |