C7H13NO4 — CID 10773584
(2S,3R,4R,5R)-6-(hydroxymethyl)-2-methyl-2,3,4,5-tetrahydropyridine-3,4,5-triol (PubChem CID 10773584) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is (2S,3R,4R,5R)-6-(hydroxymethyl)-2-methyl-2,3,4,5-tetrahydropyridine-3,4,5-triol.
| Compound Name | (2S,3R,4R,5R)-6-(hydroxymethyl)-2-methyl-2,3,4,5-tetrahydropyridine-3,4,5-triol |
|---|---|
| PubChem CID | 10773584 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (2S,3R,4R,5R)-6-(hydroxymethyl)-2-methyl-2,3,4,5-tetrahydropyridine-3,4,5-triol |
| SMILES | C[C@@H]1N=C(CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H13NO4/c1-3-5(10)7(12)6(11)4(2-9)8-3/h3,5-7,9-12H,2H2,1H3/t3-,5+,6+,7+/m0/s1 |
| InChIKey | NNPQTLQVHYCKMM-UISOVIGQSA-N |
| XLogP | -2.10 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |