C8H16N2O — CID 175638369
(1R,6S,7S)-1,7-dimethyl-3,8-diazabicyclo[3.2.1]octan-6-ol (PubChem CID 175638369) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is (1R,6S,7S)-1,7-dimethyl-3,8-diazabicyclo[3.2.1]octan-6-ol.
| Compound Name | (1R,6S,7S)-1,7-dimethyl-3,8-diazabicyclo[3.2.1]octan-6-ol |
|---|---|
| PubChem CID | 175638369 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (1R,6S,7S)-1,7-dimethyl-3,8-diazabicyclo[3.2.1]octan-6-ol |
| SMILES | C[C@@H]1[C@H](O)C2CNC[C@]1(C)N2 |
| InChI | InChI=1S/C8H16N2O/c1-5-7(11)6-3-9-4-8(5,2)10-6/h5-7,9-11H,3-4H2,1-2H3/t5-,6?,7+,8+/m1/s1 |
| InChIKey | FVLHIRHLLVXWLT-BJLRKGDGSA-N |
| XLogP | -0.68 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |