C12H22N2O4 — CID 67480404
(3aR,4R,5R,6R,7aS)-2-(diethylamino)-6-(hydroxymethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-4,5-diol (PubChem CID 67480404) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is (3aR,4R,5R,6R,7aS)-2-(diethylamino)-6-(hydroxymethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-4,5-diol.
| Compound Name | (3aR,4R,5R,6R,7aS)-2-(diethylamino)-6-(hydroxymethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-4,5-diol |
|---|---|
| PubChem CID | 67480404 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (3aR,4R,5R,6R,7aS)-2-(diethylamino)-6-(hydroxymethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-4,5-diol |
| SMILES | CCN(CC)C1=N[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)C[C@@H]2O1 |
| InChI | InChI=1S/C12H22N2O4/c1-3-14(4-2)12-13-9-8(18-12)5-7(6-15)10(16)11(9)17/h7-11,15-17H,3-6H2,1-2H3/t7-,8+,9+,10-,11-/m1/s1 |
| InChIKey | MFVQEWVSBVNFRK-ZKKRXERASA-N |
| XLogP | -0.81 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |