C11H17FN2O3 — CID 71152194
(3aR,4R,5R,6S,7aS)-2-(azetidin-1-yl)-6-(fluoromethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-4,5-diol (PubChem CID 71152194) has the molecular formula C11H17FN2O3 and a molecular weight of 244.27 g/mol. Its IUPAC name is (3aR,4R,5R,6S,7aS)-2-(azetidin-1-yl)-6-(fluoromethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-4,5-diol.
| Compound Name | (3aR,4R,5R,6S,7aS)-2-(azetidin-1-yl)-6-(fluoromethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-4,5-diol |
|---|---|
| PubChem CID | 71152194 |
| Molecular Formula | C11H17FN2O3 |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (3aR,4R,5R,6S,7aS)-2-(azetidin-1-yl)-6-(fluoromethyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-4,5-diol |
| SMILES | O[C@@H]1[C@@H](CF)C[C@@H]2OC(N3CCC3)=N[C@@H]2[C@H]1O |
| InChI | InChI=1S/C11H17FN2O3/c12-5-6-4-7-8(10(16)9(6)15)13-11(17-7)14-2-1-3-14/h6-10,15-16H,1-5H2/t6-,7+,8+,9-,10-/m1/s1 |
| InChIKey | BXEVNKAJDKVIQI-SOYHJAILSA-N |
| XLogP | -0.47 |
| TPSA | 65.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |