C9H13F3N2O2 — CID 71152423
(3aS,4S,5R,6S,7aS)-6-(difluoromethyl)-4-fluoro-2-(methylamino)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-5-ol (PubChem CID 71152423) has the molecular formula C9H13F3N2O2 and a molecular weight of 238.21 g/mol. Its IUPAC name is (3aS,4S,5R,6S,7aS)-6-(difluoromethyl)-4-fluoro-2-(methylamino)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-5-ol.
| Compound Name | (3aS,4S,5R,6S,7aS)-6-(difluoromethyl)-4-fluoro-2-(methylamino)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-5-ol |
|---|---|
| PubChem CID | 71152423 |
| Molecular Formula | C9H13F3N2O2 |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | (3aS,4S,5R,6S,7aS)-6-(difluoromethyl)-4-fluoro-2-(methylamino)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-5-ol |
| SMILES | CNC1=N[C@@H]2[C@H](F)[C@H](O)[C@@H](C(F)F)C[C@@H]2O1 |
| InChI | InChI=1S/C9H13F3N2O2/c1-13-9-14-6-4(16-9)2-3(8(11)12)7(15)5(6)10/h3-8,15H,2H2,1H3,(H,13,14)/t3-,4-,5-,6-,7+/m0/s1 |
| InChIKey | BKTIUYCOHHANJR-AZEWMMITSA-N |
| XLogP | 0.31 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |