About (4R)-4-butyl-N,N-dimethyl-4,5-dihydro-1,3-oxazol-2-amine
(4R)-4-butyl-N,N-dimethyl-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 15939238) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is (4R)-4-butyl-N,N-dimethyl-4,5-dihydro-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | (4R)-4-butyl-N,N-dimethyl-4,5-dihydro-1,3-oxazol-2-amine |
| PubChem CID | 15939238 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | (4R)-4-butyl-N,N-dimethyl-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | CCCC[C@@H]1COC(N(C)C)=N1 |
| InChI | InChI=1S/C9H18N2O/c1-4-5-6-8-7-12-9(10-8)11(2)3/h8H,4-7H2,1-3H3/t8-/m1/s1 |
| InChIKey | WWWVTXZVYXQGMB-MRVPVSSYSA-N |
| XLogP | 1.49 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-4-butyl-N,N-dimethyl-4,5-dihydro-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-butyl-N,N-dimethyl-4,5-dihydro-1,3-oxazol-2-amine?
The IUPAC name of (4R)-4-butyl-N,N-dimethyl-4,5-dihydro-1,3-oxazol-2-amine (CID 15939238) is (4R)-4-butyl-N,N-dimethyl-4,5-dihydro-1,3-oxazol-2-amine.
What is the SMILES notation for (4R)-4-butyl-N,N-dimethyl-4,5-dihydro-1,3-oxazol-2-amine?
The canonical SMILES for (4R)-4-butyl-N,N-dimethyl-4,5-dihydro-1,3-oxazol-2-amine is CCCC[C@@H]1COC(N(C)C)=N1.
What is the InChIKey of (4R)-4-butyl-N,N-dimethyl-4,5-dihydro-1,3-oxazol-2-amine?
The InChIKey is WWWVTXZVYXQGMB-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H18N2O/c1-4-5-6-8-7-12-9(10-8)11(2)3/h8H,4-7H2,1-3H3/t8-/m1/s1.
What are the key properties of (4R)-4-butyl-N,N-dimethyl-4,5-dihydro-1,3-oxazol-2-amine?
(4R)-4-butyl-N,N-dimethyl-4,5-dihydro-1,3-oxazol-2-amine has a molecular weight of 170.26 g/mol, XLogP of 1.49, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-butyl-N,N-dimethyl-4,5-dihydro-1,3-oxazol-2-amine is sourced from PubChem (CID 15939238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).