C23H23F4N3O3S — CID 118227825
4-[3-[(3E,5Z)-2-fluoro-7-(3-hydroxypropoxy)hepta-1,3,5-trien-4-yl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 118227825) has the molecular formula C23H23F4N3O3S and a molecular weight of 497.51 g/mol. Its IUPAC name is 4-[3-[(3E,5Z)-2-fluoro-7-(3-hydroxypropoxy)hepta-1,3,5-trien-4-yl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[(3E,5Z)-2-fluoro-7-(3-hydroxypropoxy)hepta-1,3,5-trien-4-yl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 118227825 |
| Molecular Formula | C23H23F4N3O3S |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | 4-[3-[(3E,5Z)-2-fluoro-7-(3-hydroxypropoxy)hepta-1,3,5-trien-4-yl]-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | C=C(F)/C=C(\C=C/COCCCO)N1C(=S)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=O)C1(C)C |
| InChI | InChI=1S/C23H23F4N3O3S/c1-15(24)12-18(6-4-10-33-11-5-9-31)30-21(34)29(20(32)22(30,2)3)17-8-7-16(14-28)19(13-17)23(25,26)27/h4,6-8,12-13,31H,1,5,9-11H2,2-3H3/b6-4-,18-12+ |
| InChIKey | IELPKRMOOKBGSA-WZMVWGNZSA-N |
| XLogP | 4.61 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|