C20H24N4O2 — CID 118230372
ethyl 4-[benzotriazol-1-ylmethyl(benzyl)amino]butanoate (PubChem CID 118230372) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is ethyl 4-[benzotriazol-1-ylmethyl(benzyl)amino]butanoate.
| Compound Name | ethyl 4-[benzotriazol-1-ylmethyl(benzyl)amino]butanoate |
|---|---|
| PubChem CID | 118230372 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | ethyl 4-[benzotriazol-1-ylmethyl(benzyl)amino]butanoate |
| SMILES | CCOC(=O)CCCN(Cc1ccccc1)Cn1nnc2ccccc21 |
| InChI | InChI=1S/C20H24N4O2/c1-2-26-20(25)13-8-14-23(15-17-9-4-3-5-10-17)16-24-19-12-7-6-11-18(19)21-22-24/h3-7,9-12H,2,8,13-16H2,1H3 |
| InChIKey | XXBSNXFTCXLIGP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |