C11H22N2 — CID 118230703
(7R,8aS)-7-methyl-2-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 118230703) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is (7R,8aS)-7-methyl-2-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (7R,8aS)-7-methyl-2-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 118230703 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | (7R,8aS)-7-methyl-2-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CC(C)N1CCN2C[C@H](C)C[C@H]2C1 |
| InChI | InChI=1S/C11H22N2/c1-9(2)12-4-5-13-7-10(3)6-11(13)8-12/h9-11H,4-8H2,1-3H3/t10-,11+/m1/s1 |
| InChIKey | QZAWPDFVLPLTNL-MNOVXSKESA-N |
| XLogP | 1.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |