C20H38N4O — CID 135213361
7-[(2R)-2-[4-(oxetan-3-yl)piperazin-1-yl]propyl]-2-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 135213361) has the molecular formula C20H38N4O and a molecular weight of 350.55 g/mol. Its IUPAC name is 7-[(2R)-2-[4-(oxetan-3-yl)piperazin-1-yl]propyl]-2-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 7-[(2R)-2-[4-(oxetan-3-yl)piperazin-1-yl]propyl]-2-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 135213361 |
| Molecular Formula | C20H38N4O |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | 7-[(2R)-2-[4-(oxetan-3-yl)piperazin-1-yl]propyl]-2-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CC(C)N1CCN2CC(C[C@@H](C)N3CCN(C4COC4)CC3)CC2C1 |
| InChI | InChI=1S/C20H38N4O/c1-16(2)23-8-9-24-12-18(11-19(24)13-23)10-17(3)21-4-6-22(7-5-21)20-14-25-15-20/h16-20H,4-15H2,1-3H3/t17-,18?,19?/m1/s1 |
| InChIKey | XACYNADDEJNPNE-LMDPOFIKSA-N |
| XLogP | 1.20 |
| TPSA | 22.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |