About [(2S)-3-(methanesulfonamido)-2-propan-2-yloxypropyl] 2-piperidin-4-ylacetate
[(2S)-3-(methanesulfonamido)-2-propan-2-yloxypropyl] 2-piperidin-4-ylacetate (PubChem CID 118241736) has the molecular formula C14H28N2O5S
and a molecular weight of 336.45 g/mol. Its IUPAC name is [(2S)-3-(methanesulfonamido)-2-propan-2-yloxypropyl] 2-piperidin-4-ylacetate.
Molecular Properties
| Compound Name | [(2S)-3-(methanesulfonamido)-2-propan-2-yloxypropyl] 2-piperidin-4-ylacetate |
| PubChem CID | 118241736 |
| Molecular Formula | C14H28N2O5S |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | [(2S)-3-(methanesulfonamido)-2-propan-2-yloxypropyl] 2-piperidin-4-ylacetate |
| SMILES | CC(C)O[C@@H](CNS(C)(=O)=O)COC(=O)CC1CCNCC1 |
| InChI | InChI=1S/C14H28N2O5S/c1-11(2)21-13(9-16-22(3,18)19)10-20-14(17)8-12-4-6-15-7-5-12/h11-13,15-16H,4-10H2,1-3H3/t13-/m0/s1 |
| InChIKey | KKOIHJUTQYHWLB-ZDUSSCGKSA-N |
| XLogP | 0.26 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(2S)-3-(methanesulfonamido)-2-propan-2-yloxypropyl] 2-piperidin-4-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-3-(methanesulfonamido)-2-propan-2-yloxypropyl] 2-piperidin-4-ylacetate?
The IUPAC name of [(2S)-3-(methanesulfonamido)-2-propan-2-yloxypropyl] 2-piperidin-4-ylacetate (CID 118241736) is [(2S)-3-(methanesulfonamido)-2-propan-2-yloxypropyl] 2-piperidin-4-ylacetate.
What is the SMILES notation for [(2S)-3-(methanesulfonamido)-2-propan-2-yloxypropyl] 2-piperidin-4-ylacetate?
The canonical SMILES for [(2S)-3-(methanesulfonamido)-2-propan-2-yloxypropyl] 2-piperidin-4-ylacetate is CC(C)O[C@@H](CNS(C)(=O)=O)COC(=O)CC1CCNCC1.
What is the InChIKey of [(2S)-3-(methanesulfonamido)-2-propan-2-yloxypropyl] 2-piperidin-4-ylacetate?
The InChIKey is KKOIHJUTQYHWLB-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H28N2O5S/c1-11(2)21-13(9-16-22(3,18)19)10-20-14(17)8-12-4-6-15-7-5-12/h11-13,15-16H,4-10H2,1-3H3/t13-/m0/s1.
What are the key properties of [(2S)-3-(methanesulfonamido)-2-propan-2-yloxypropyl] 2-piperidin-4-ylacetate?
[(2S)-3-(methanesulfonamido)-2-propan-2-yloxypropyl] 2-piperidin-4-ylacetate has a molecular weight of 336.45 g/mol, XLogP of 0.26, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-3-(methanesulfonamido)-2-propan-2-yloxypropyl] 2-piperidin-4-ylacetate is sourced from PubChem (CID 118241736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).