C14H28N2O6S — CID 70811775
[(2S)-2-[(2S)-butan-2-yl]oxy-3-(methanesulfonamido)propyl] piperidin-4-yl carbonate (PubChem CID 70811775) has the molecular formula C14H28N2O6S and a molecular weight of 352.45 g/mol. Its IUPAC name is [(2S)-2-[(2S)-butan-2-yl]oxy-3-(methanesulfonamido)propyl] piperidin-4-yl carbonate.
| Compound Name | [(2S)-2-[(2S)-butan-2-yl]oxy-3-(methanesulfonamido)propyl] piperidin-4-yl carbonate |
|---|---|
| PubChem CID | 70811775 |
| Molecular Formula | C14H28N2O6S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | [(2S)-2-[(2S)-butan-2-yl]oxy-3-(methanesulfonamido)propyl] piperidin-4-yl carbonate |
| SMILES | CC[C@H](C)O[C@@H](CNS(C)(=O)=O)COC(=O)OC1CCNCC1 |
| InChI | InChI=1S/C14H28N2O6S/c1-4-11(2)21-13(9-16-23(3,18)19)10-20-14(17)22-12-5-7-15-8-6-12/h11-13,15-16H,4-10H2,1-3H3/t11-,13-/m0/s1 |
| InChIKey | PQUVCJXKECQTAA-AAEUAGOBSA-N |
| XLogP | 0.62 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |