C21H27ClN4O3 — CID 118242128
ethyl (3S)-3-(3-tert-butyl-5-pyrimidin-5-ylphenyl)-3-[[2-(chloroamino)acetyl]amino]propanoate (PubChem CID 118242128) has the molecular formula C21H27ClN4O3 and a molecular weight of 418.93 g/mol. Its IUPAC name is ethyl (3S)-3-(3-tert-butyl-5-pyrimidin-5-ylphenyl)-3-[[2-(chloroamino)acetyl]amino]propanoate.
| Compound Name | ethyl (3S)-3-(3-tert-butyl-5-pyrimidin-5-ylphenyl)-3-[[2-(chloroamino)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 118242128 |
| Molecular Formula | C21H27ClN4O3 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | ethyl (3S)-3-(3-tert-butyl-5-pyrimidin-5-ylphenyl)-3-[[2-(chloroamino)acetyl]amino]propanoate |
| SMILES | CCOC(=O)C[C@H](NC(=O)CNCl)c1cc(-c2cncnc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H27ClN4O3/c1-5-29-20(28)9-18(26-19(27)12-25-22)15-6-14(16-10-23-13-24-11-16)7-17(8-15)21(2,3)4/h6-8,10-11,13,18,25H,5,9,12H2,1-4H3,(H,26,27)/t18-/m0/s1 |
| InChIKey | RNZYZIWJHZASJV-SFHVURJKSA-N |
| XLogP | 3.30 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|