C13H16FNO3 — CID 118242707
4-fluoro-2-[(1R,3R)-3-methoxycyclohexyl]oxy-1-nitrosobenzene (PubChem CID 118242707) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is 4-fluoro-2-[(1R,3R)-3-methoxycyclohexyl]oxy-1-nitrosobenzene.
| Compound Name | 4-fluoro-2-[(1R,3R)-3-methoxycyclohexyl]oxy-1-nitrosobenzene |
|---|---|
| PubChem CID | 118242707 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-fluoro-2-[(1R,3R)-3-methoxycyclohexyl]oxy-1-nitrosobenzene |
| SMILES | CO[C@@H]1CCC[C@@H](Oc2cc(F)ccc2N=O)C1 |
| InChI | InChI=1S/C13H16FNO3/c1-17-10-3-2-4-11(8-10)18-13-7-9(14)5-6-12(13)15-16/h5-7,10-11H,2-4,8H2,1H3/t10-,11-/m1/s1 |
| InChIKey | VCFFPMQSDOPRGM-GHMZBOCLSA-N |
| XLogP | 3.56 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |