C25H29NO6 — CID 118251811
ethyl 6-(cyclobutadienyl)-10-methoxy-9-(3-methoxypropoxy)-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate (PubChem CID 118251811) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is ethyl 6-(cyclobutadienyl)-10-methoxy-9-(3-methoxypropoxy)-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate.
| Compound Name | ethyl 6-(cyclobutadienyl)-10-methoxy-9-(3-methoxypropoxy)-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 118251811 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | ethyl 6-(cyclobutadienyl)-10-methoxy-9-(3-methoxypropoxy)-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate |
| SMILES | CCOC(=O)C1=CN2C(C3=CC=C3)Cc3cc(OCCCOC)c(OC)cc3C2CC1=O |
| InChI | InChI=1S/C25H29NO6/c1-4-31-25(28)19-15-26-20(16-7-5-8-16)11-17-12-24(32-10-6-9-29-2)23(30-3)13-18(17)21(26)14-22(19)27/h5,7-8,12-13,15,20-21H,4,6,9-11,14H2,1-3H3 |
| InChIKey | GZWRUOJMMRDQKL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|