C19H20F3NO5 — CID 118252122
ethyl 9,10-dimethoxy-2-oxo-6-(trifluoromethyl)-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate (PubChem CID 118252122) has the molecular formula C19H20F3NO5 and a molecular weight of 399.37 g/mol. Its IUPAC name is ethyl 9,10-dimethoxy-2-oxo-6-(trifluoromethyl)-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate.
| Compound Name | ethyl 9,10-dimethoxy-2-oxo-6-(trifluoromethyl)-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 118252122 |
| Molecular Formula | C19H20F3NO5 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | ethyl 9,10-dimethoxy-2-oxo-6-(trifluoromethyl)-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate |
| SMILES | CCOC(=O)C1=CN2C(CC1=O)c1cc(OC)c(OC)cc1CC2C(F)(F)F |
| InChI | InChI=1S/C19H20F3NO5/c1-4-28-18(25)12-9-23-13(8-14(12)24)11-7-16(27-3)15(26-2)5-10(11)6-17(23)19(20,21)22/h5,7,9,13,17H,4,6,8H2,1-3H3 |
| InChIKey | RZUHERFMOAJVMY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|