C23H29NO6 — CID 118285573
ethyl 10-hydroxy-9-(3-hydroxypropoxy)-6-(1-methylcyclopropyl)-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate (PubChem CID 118285573) has the molecular formula C23H29NO6 and a molecular weight of 415.49 g/mol. Its IUPAC name is ethyl 10-hydroxy-9-(3-hydroxypropoxy)-6-(1-methylcyclopropyl)-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate.
| Compound Name | ethyl 10-hydroxy-9-(3-hydroxypropoxy)-6-(1-methylcyclopropyl)-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 118285573 |
| Molecular Formula | C23H29NO6 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | ethyl 10-hydroxy-9-(3-hydroxypropoxy)-6-(1-methylcyclopropyl)-2-oxo-1,6,7,11b-tetrahydrobenzo[a]quinolizine-3-carboxylate |
| SMILES | CCOC(=O)C1=CN2C(CC1=O)c1cc(O)c(OCCCO)cc1CC2C1(C)CC1 |
| InChI | InChI=1S/C23H29NO6/c1-3-29-22(28)16-13-24-17(12-18(16)26)15-11-19(27)20(30-8-4-7-25)9-14(15)10-21(24)23(2)5-6-23/h9,11,13,17,21,25,27H,3-8,10,12H2,1-2H3 |
| InChIKey | NRJXKVBLFQGESM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|