C15H29NO5S — CID 118252717
tert-butyl (3R,4S)-3-hydroxy-4-[2-[2-(2-hydroxyethoxy)ethylsulfanyl]ethyl]pyrrolidine-1-carboxylate (PubChem CID 118252717) has the molecular formula C15H29NO5S and a molecular weight of 335.47 g/mol. Its IUPAC name is tert-butyl (3R,4S)-3-hydroxy-4-[2-[2-(2-hydroxyethoxy)ethylsulfanyl]ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-3-hydroxy-4-[2-[2-(2-hydroxyethoxy)ethylsulfanyl]ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118252717 |
| Molecular Formula | C15H29NO5S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | tert-butyl (3R,4S)-3-hydroxy-4-[2-[2-(2-hydroxyethoxy)ethylsulfanyl]ethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](CCSCCOCCO)[C@@H](O)C1 |
| InChI | InChI=1S/C15H29NO5S/c1-15(2,3)21-14(19)16-10-12(13(18)11-16)4-8-22-9-7-20-6-5-17/h12-13,17-18H,4-11H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | AYTAFRKPFHOJNQ-STQMWFEESA-N |
| XLogP | 1.35 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|