C11H21NO5 — CID 57000258
tert-butyl (3S)-3-hydroxy-4-(2-hydroxyethoxy)pyrrolidine-1-carboxylate (PubChem CID 57000258) has the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. Its IUPAC name is tert-butyl (3S)-3-hydroxy-4-(2-hydroxyethoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-hydroxy-4-(2-hydroxyethoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57000258 |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | tert-butyl (3S)-3-hydroxy-4-(2-hydroxyethoxy)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(OCCO)[C@@H](O)C1 |
| InChI | InChI=1S/C11H21NO5/c1-11(2,3)17-10(15)12-6-8(14)9(7-12)16-5-4-13/h8-9,13-14H,4-7H2,1-3H3/t8-,9?/m0/s1 |
| InChIKey | LTXUCOMZDWCUPT-IENPIDJESA-N |
| XLogP | -0.02 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |