C11H20BrNO4 — CID 156519596
tert-butyl (3R)-3-bromo-4-(2-hydroxyethoxy)pyrrolidine-1-carboxylate (PubChem CID 156519596) has the molecular formula C11H20BrNO4 and a molecular weight of 310.19 g/mol. Its IUPAC name is tert-butyl (3R)-3-bromo-4-(2-hydroxyethoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-bromo-4-(2-hydroxyethoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156519596 |
| Molecular Formula | C11H20BrNO4 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | tert-butyl (3R)-3-bromo-4-(2-hydroxyethoxy)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(OCCO)[C@H](Br)C1 |
| InChI | InChI=1S/C11H20BrNO4/c1-11(2,3)17-10(15)13-6-8(12)9(7-13)16-5-4-14/h8-9,14H,4-7H2,1-3H3/t8-,9?/m1/s1 |
| InChIKey | FJSGHPQXHOBEOW-VEDVMXKPSA-N |
| XLogP | 1.38 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|