C16H30BrNO3 — CID 165486355
tert-butyl 3-bromo-4-(4,4-dimethylpentoxy)pyrrolidine-1-carboxylate (PubChem CID 165486355) has the molecular formula C16H30BrNO3 and a molecular weight of 364.32 g/mol. Its IUPAC name is tert-butyl 3-bromo-4-(4,4-dimethylpentoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-bromo-4-(4,4-dimethylpentoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 165486355 |
| Molecular Formula | C16H30BrNO3 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | tert-butyl 3-bromo-4-(4,4-dimethylpentoxy)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)CCCOC1CN(C(=O)OC(C)(C)C)CC1Br |
| InChI | InChI=1S/C16H30BrNO3/c1-15(2,3)8-7-9-20-13-11-18(10-12(13)17)14(19)21-16(4,5)6/h12-13H,7-11H2,1-6H3 |
| InChIKey | SBHCZFCMVNLWJT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|