C11H17BrF3NO3 — CID 114773878
tert-butyl 3-bromo-4-(2,2,2-trifluoroethoxy)pyrrolidine-1-carboxylate (PubChem CID 114773878) has the molecular formula C11H17BrF3NO3 and a molecular weight of 348.16 g/mol. Its IUPAC name is tert-butyl 3-bromo-4-(2,2,2-trifluoroethoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-bromo-4-(2,2,2-trifluoroethoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 114773878 |
| Molecular Formula | C11H17BrF3NO3 |
| Molecular Weight | 348.16 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | tert-butyl 3-bromo-4-(2,2,2-trifluoroethoxy)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Br)C(OCC(F)(F)F)C1 |
| InChI | InChI=1S/C11H17BrF3NO3/c1-10(2,3)19-9(17)16-4-7(12)8(5-16)18-6-11(13,14)15/h7-8H,4-6H2,1-3H3 |
| InChIKey | RASVQTJTXORRGC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.16 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|