C11H8Br3F — CID 11825495
1-fluoro-4-[(3R,5S)-2,3,5-tribromocyclopenten-1-yl]benzene (PubChem CID 11825495) has the molecular formula C11H8Br3F and a molecular weight of 398.90 g/mol. Its IUPAC name is 1-fluoro-4-[(3R,5S)-2,3,5-tribromocyclopenten-1-yl]benzene.
| Compound Name | 1-fluoro-4-[(3R,5S)-2,3,5-tribromocyclopenten-1-yl]benzene |
|---|---|
| PubChem CID | 11825495 |
| Molecular Formula | C11H8Br3F |
| Molecular Weight | 398.90 g/mol |
| Exact Mass | 395.82 |
| IUPAC Name | 1-fluoro-4-[(3R,5S)-2,3,5-tribromocyclopenten-1-yl]benzene |
| SMILES | Fc1ccc(C2=C(Br)[C@H](Br)C[C@@H]2Br)cc1 |
| InChI | InChI=1S/C11H8Br3F/c12-8-5-9(13)11(14)10(8)6-1-3-7(15)4-2-6/h1-4,8-9H,5H2/t8-,9+/m0/s1 |
| InChIKey | TXIZZLGTWVZGAD-DTWKUNHWSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.90 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|