C29H18F4O — CID 102265696
2,3,4,5-tetrakis(4-fluorophenyl)cyclopenta-2,4-dien-1-ol (PubChem CID 102265696) has the molecular formula C29H18F4O and a molecular weight of 458.45 g/mol. Its IUPAC name is 2,3,4,5-tetrakis(4-fluorophenyl)cyclopenta-2,4-dien-1-ol.
| Compound Name | 2,3,4,5-tetrakis(4-fluorophenyl)cyclopenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 102265696 |
| Molecular Formula | C29H18F4O |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 2,3,4,5-tetrakis(4-fluorophenyl)cyclopenta-2,4-dien-1-ol |
| SMILES | OC1C(c2ccc(F)cc2)=C(c2ccc(F)cc2)C(c2ccc(F)cc2)=C1c1ccc(F)cc1 |
| InChI | InChI=1S/C29H18F4O/c30-21-9-1-17(2-10-21)25-26(18-3-11-22(31)12-4-18)28(20-7-15-24(33)16-8-20)29(34)27(25)19-5-13-23(32)14-6-19/h1-16,29,34H |
| InChIKey | VZSOHBCZDPDTQD-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|