C16H11FO4 — CID 91118384
5-[4-(4-fluorophenyl)phenyl]-3-hydroxyoxolane-2,4-dione (PubChem CID 91118384) has the molecular formula C16H11FO4 and a molecular weight of 286.26 g/mol. Its IUPAC name is 5-[4-(4-fluorophenyl)phenyl]-3-hydroxyoxolane-2,4-dione.
| Compound Name | 5-[4-(4-fluorophenyl)phenyl]-3-hydroxyoxolane-2,4-dione |
|---|---|
| PubChem CID | 91118384 |
| Molecular Formula | C16H11FO4 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 5-[4-(4-fluorophenyl)phenyl]-3-hydroxyoxolane-2,4-dione |
| SMILES | O=C1OC(c2ccc(-c3ccc(F)cc3)cc2)C(=O)C1O |
| InChI | InChI=1S/C16H11FO4/c17-12-7-5-10(6-8-12)9-1-3-11(4-2-9)15-13(18)14(19)16(20)21-15/h1-8,14-15,19H |
| InChIKey | STZURXJITXAWGB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|