C18H12F2 — CID 139880103
1-fluoro-4-[2-(4-fluorophenyl)-3-methylidenecyclopenta-1,4-dien-1-yl]benzene (PubChem CID 139880103) has the molecular formula C18H12F2 and a molecular weight of 266.29 g/mol. Its IUPAC name is 1-fluoro-4-[2-(4-fluorophenyl)-3-methylidenecyclopenta-1,4-dien-1-yl]benzene.
| Compound Name | 1-fluoro-4-[2-(4-fluorophenyl)-3-methylidenecyclopenta-1,4-dien-1-yl]benzene |
|---|---|
| PubChem CID | 139880103 |
| Molecular Formula | C18H12F2 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 1-fluoro-4-[2-(4-fluorophenyl)-3-methylidenecyclopenta-1,4-dien-1-yl]benzene |
| SMILES | C=C1C=CC(c2ccc(F)cc2)=C1c1ccc(F)cc1 |
| InChI | InChI=1S/C18H12F2/c1-12-2-11-17(13-3-7-15(19)8-4-13)18(12)14-5-9-16(20)10-6-14/h2-11H,1H2 |
| InChIKey | WYJNQZDWUUCISN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|