C10H9FO2 — CID 130142404
3-(4-fluorophenyl)cyclobut-3-ene-1,2-diol (PubChem CID 130142404) has the molecular formula C10H9FO2 and a molecular weight of 180.18 g/mol. Its IUPAC name is 3-(4-fluorophenyl)cyclobut-3-ene-1,2-diol.
| Compound Name | 3-(4-fluorophenyl)cyclobut-3-ene-1,2-diol |
|---|---|
| PubChem CID | 130142404 |
| Molecular Formula | C10H9FO2 |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 3-(4-fluorophenyl)cyclobut-3-ene-1,2-diol |
| SMILES | OC1C=C(c2ccc(F)cc2)C1O |
| InChI | InChI=1S/C10H9FO2/c11-7-3-1-6(2-4-7)8-5-9(12)10(8)13/h1-5,9-10,12-13H |
| InChIKey | NLEUJFDPUDBXKJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |