C10H10FN3 — CID 163986258
5-(4-fluorophenyl)-1,4-dihydropyrimidin-4-amine (PubChem CID 163986258) has the molecular formula C10H10FN3 and a molecular weight of 191.21 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-1,4-dihydropyrimidin-4-amine.
| Compound Name | 5-(4-fluorophenyl)-1,4-dihydropyrimidin-4-amine |
|---|---|
| PubChem CID | 163986258 |
| Molecular Formula | C10H10FN3 |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 5-(4-fluorophenyl)-1,4-dihydropyrimidin-4-amine |
| SMILES | NC1N=CNC=C1c1ccc(F)cc1 |
| InChI | InChI=1S/C10H10FN3/c11-8-3-1-7(2-4-8)9-5-13-6-14-10(9)12/h1-6,10H,12H2,(H,13,14) |
| InChIKey | TWPUVXALINUOMD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |