C11H11FN2 — CID 86341374
3-(4-fluorophenyl)-1,2-dihydropyridin-4-amine (PubChem CID 86341374) has the molecular formula C11H11FN2 and a molecular weight of 190.22 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1,2-dihydropyridin-4-amine.
| Compound Name | 3-(4-fluorophenyl)-1,2-dihydropyridin-4-amine |
|---|---|
| PubChem CID | 86341374 |
| Molecular Formula | C11H11FN2 |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 3-(4-fluorophenyl)-1,2-dihydropyridin-4-amine |
| SMILES | NC1=C(c2ccc(F)cc2)CNC=C1 |
| InChI | InChI=1S/C11H11FN2/c12-9-3-1-8(2-4-9)10-7-14-6-5-11(10)13/h1-6,14H,7,13H2 |
| InChIKey | JXIQYDKSEAAGMG-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |