C22H25FN6O3 — CID 118262471
tert-butyl N-(2-fluoroethyl)-N-[6-[(3-oxo-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-11-yl)amino]-3-pyridinyl]carbamate (PubChem CID 118262471) has the molecular formula C22H25FN6O3 and a molecular weight of 440.48 g/mol. Its IUPAC name is tert-butyl N-(2-fluoroethyl)-N-[6-[(3-oxo-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-11-yl)amino]-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-(2-fluoroethyl)-N-[6-[(3-oxo-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-11-yl)amino]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 118262471 |
| Molecular Formula | C22H25FN6O3 |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | tert-butyl N-(2-fluoroethyl)-N-[6-[(3-oxo-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-11-yl)amino]-3-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCF)c1ccc(Nc2ccc3c4c([nH]c3n2)CCNC4=O)nc1 |
| InChI | InChI=1S/C22H25FN6O3/c1-22(2,3)32-21(31)29(11-9-23)13-4-6-16(25-12-13)27-17-7-5-14-18-15(26-19(14)28-17)8-10-24-20(18)30/h4-7,12H,8-11H2,1-3H3,(H,24,30)(H2,25,26,27,28) |
| InChIKey | LYDWQLXPBDVQIC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |