C15H22BrN3O3 — CID 164584734
tert-butyl N-[6-[(2-bromoacetyl)amino]-3-pyridinyl]-N-propylcarbamate (PubChem CID 164584734) has the molecular formula C15H22BrN3O3 and a molecular weight of 372.26 g/mol. Its IUPAC name is tert-butyl N-[6-[(2-bromoacetyl)amino]-3-pyridinyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[6-[(2-bromoacetyl)amino]-3-pyridinyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 164584734 |
| Molecular Formula | C15H22BrN3O3 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | tert-butyl N-[6-[(2-bromoacetyl)amino]-3-pyridinyl]-N-propylcarbamate |
| SMILES | CCCN(C(=O)OC(C)(C)C)c1ccc(NC(=O)CBr)nc1 |
| InChI | InChI=1S/C15H22BrN3O3/c1-5-8-19(14(21)22-15(2,3)4)11-6-7-12(17-10-11)18-13(20)9-16/h6-7,10H,5,8-9H2,1-4H3,(H,17,18,20) |
| InChIKey | JBZDGAIXRVMZMS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|