C20H19N5O2 — CID 118265385
N-[1-[3-[(E)-3-amino-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]azetidin-3-yl]benzamide (PubChem CID 118265385) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is N-[1-[3-[(E)-3-amino-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]azetidin-3-yl]benzamide.
| Compound Name | N-[1-[3-[(E)-3-amino-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]azetidin-3-yl]benzamide |
|---|---|
| PubChem CID | 118265385 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-[1-[3-[(E)-3-amino-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]azetidin-3-yl]benzamide |
| SMILES | NC(=O)/C=C/c1c[nH]c2ncc(N3CC(NC(=O)c4ccccc4)C3)cc12 |
| InChI | InChI=1S/C20H19N5O2/c21-18(26)7-6-14-9-22-19-17(14)8-16(10-23-19)25-11-15(12-25)24-20(27)13-4-2-1-3-5-13/h1-10,15H,11-12H2,(H2,21,26)(H,22,23)(H,24,27)/b7-6+ |
| InChIKey | LJRZUONFDPWZNG-VOTSOKGWSA-N |
| XLogP | 1.68 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|