C18H22N4O3 — CID 122705642
(E)-4-[5-[4-[(2R)-2-hydroxypropanoyl]piperazin-1-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]but-3-en-2-one (PubChem CID 122705642) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is (E)-4-[5-[4-[(2R)-2-hydroxypropanoyl]piperazin-1-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]but-3-en-2-one.
| Compound Name | (E)-4-[5-[4-[(2R)-2-hydroxypropanoyl]piperazin-1-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 122705642 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (E)-4-[5-[4-[(2R)-2-hydroxypropanoyl]piperazin-1-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1c[nH]c2ncc(N3CCN(C(=O)[C@@H](C)O)CC3)cc12 |
| InChI | InChI=1S/C18H22N4O3/c1-12(23)3-4-14-10-19-17-16(14)9-15(11-20-17)21-5-7-22(8-6-21)18(25)13(2)24/h3-4,9-11,13,24H,5-8H2,1-2H3,(H,19,20)/b4-3+/t13-/m1/s1 |
| InChIKey | DPZPTSJJFXRUFV-ITDFMYJTSA-N |
| XLogP | 1.19 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|