C18H22FN5O3 — CID 118267505
3-fluoropropyl 4-[3-[(E)-3-amino-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]piperazine-1-carboxylate (PubChem CID 118267505) has the molecular formula C18H22FN5O3 and a molecular weight of 375.40 g/mol. Its IUPAC name is 3-fluoropropyl 4-[3-[(E)-3-amino-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]piperazine-1-carboxylate.
| Compound Name | 3-fluoropropyl 4-[3-[(E)-3-amino-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 118267505 |
| Molecular Formula | C18H22FN5O3 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 3-fluoropropyl 4-[3-[(E)-3-amino-3-oxoprop-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]piperazine-1-carboxylate |
| SMILES | NC(=O)/C=C/c1c[nH]c2ncc(N3CCN(C(=O)OCCCF)CC3)cc12 |
| InChI | InChI=1S/C18H22FN5O3/c19-4-1-9-27-18(26)24-7-5-23(6-8-24)14-10-15-13(2-3-16(20)25)11-21-17(15)22-12-14/h2-3,10-12H,1,4-9H2,(H2,20,25)(H,21,22)/b3-2+ |
| InChIKey | DGXPRXKQDXUGKN-NSCUHMNNSA-N |
| XLogP | 1.68 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|