C21H19F2N5O2 — CID 122705647
(E)-4-[5-[4-(3,5-difluoropyridine-2-carbonyl)piperazin-1-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]but-3-en-2-one (PubChem CID 122705647) has the molecular formula C21H19F2N5O2 and a molecular weight of 411.41 g/mol. Its IUPAC name is (E)-4-[5-[4-(3,5-difluoropyridine-2-carbonyl)piperazin-1-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]but-3-en-2-one.
| Compound Name | (E)-4-[5-[4-(3,5-difluoropyridine-2-carbonyl)piperazin-1-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 122705647 |
| Molecular Formula | C21H19F2N5O2 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | (E)-4-[5-[4-(3,5-difluoropyridine-2-carbonyl)piperazin-1-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1c[nH]c2ncc(N3CCN(C(=O)c4ncc(F)cc4F)CC3)cc12 |
| InChI | InChI=1S/C21H19F2N5O2/c1-13(29)2-3-14-10-25-20-17(14)9-16(12-26-20)27-4-6-28(7-5-27)21(30)19-18(23)8-15(22)11-24-19/h2-3,8-12H,4-7H2,1H3,(H,25,26)/b3-2+ |
| InChIKey | FMQCCUYJTNWAHG-NSCUHMNNSA-N |
| XLogP | 2.80 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|