C20H25N3O3 — CID 161017486
tert-butyl 2-[1-[3-[(E)-3-oxobut-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]azetidin-3-yl]acetate (PubChem CID 161017486) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is tert-butyl 2-[1-[3-[(E)-3-oxobut-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]azetidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[1-[3-[(E)-3-oxobut-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]azetidin-3-yl]acetate |
|---|---|
| PubChem CID | 161017486 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | tert-butyl 2-[1-[3-[(E)-3-oxobut-1-enyl]-1H-pyrrolo[2,3-b]pyridin-5-yl]azetidin-3-yl]acetate |
| SMILES | CC(=O)/C=C/c1c[nH]c2ncc(N3CC(CC(=O)OC(C)(C)C)C3)cc12 |
| InChI | InChI=1S/C20H25N3O3/c1-13(24)5-6-15-9-21-19-17(15)8-16(10-22-19)23-11-14(12-23)7-18(25)26-20(2,3)4/h5-6,8-10,14H,7,11-12H2,1-4H3,(H,21,22)/b6-5+ |
| InChIKey | JJJOAWDUXZAZFJ-AATRIKPKSA-N |
| XLogP | 3.33 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|