C16H20IN3O2 — CID 158978269
tert-butyl 2-[1-(3-iodo-1H-pyrrolo[2,3-b]pyridin-5-yl)azetidin-3-yl]acetate (PubChem CID 158978269) has the molecular formula C16H20IN3O2 and a molecular weight of 413.26 g/mol. Its IUPAC name is tert-butyl 2-[1-(3-iodo-1H-pyrrolo[2,3-b]pyridin-5-yl)azetidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[1-(3-iodo-1H-pyrrolo[2,3-b]pyridin-5-yl)azetidin-3-yl]acetate |
|---|---|
| PubChem CID | 158978269 |
| Molecular Formula | C16H20IN3O2 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | tert-butyl 2-[1-(3-iodo-1H-pyrrolo[2,3-b]pyridin-5-yl)azetidin-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1CN(c2cnc3[nH]cc(I)c3c2)C1 |
| InChI | InChI=1S/C16H20IN3O2/c1-16(2,3)22-14(21)4-10-8-20(9-10)11-5-12-13(17)7-19-15(12)18-6-11/h5-7,10H,4,8-9H2,1-3H3,(H,18,19) |
| InChIKey | JOQYKTSARKUNAY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|