C13H20N4O2 — CID 158627414
tert-butyl 2-[(3S)-1-(1,2,4-triazin-3-yl)pyrrolidin-3-yl]acetate (PubChem CID 158627414) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is tert-butyl 2-[(3S)-1-(1,2,4-triazin-3-yl)pyrrolidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3S)-1-(1,2,4-triazin-3-yl)pyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 158627414 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | tert-butyl 2-[(3S)-1-(1,2,4-triazin-3-yl)pyrrolidin-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@@H]1CCN(c2nccnn2)C1 |
| InChI | InChI=1S/C13H20N4O2/c1-13(2,3)19-11(18)8-10-4-7-17(9-10)12-14-5-6-15-16-12/h5-6,10H,4,7-9H2,1-3H3/t10-/m0/s1 |
| InChIKey | IHYFDEVJLRTWKM-JTQLQIEISA-N |
| XLogP | 1.43 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |