C25H36N4O2 — CID 167632250
tert-butyl 2-[(3S)-1-[6-amino-3-(1-methylpiperidin-4-yl)isoquinolin-1-yl]pyrrolidin-3-yl]acetate (PubChem CID 167632250) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is tert-butyl 2-[(3S)-1-[6-amino-3-(1-methylpiperidin-4-yl)isoquinolin-1-yl]pyrrolidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3S)-1-[6-amino-3-(1-methylpiperidin-4-yl)isoquinolin-1-yl]pyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 167632250 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | tert-butyl 2-[(3S)-1-[6-amino-3-(1-methylpiperidin-4-yl)isoquinolin-1-yl]pyrrolidin-3-yl]acetate |
| SMILES | CN1CCC(c2cc3cc(N)ccc3c(N3CC[C@@H](CC(=O)OC(C)(C)C)C3)n2)CC1 |
| InChI | InChI=1S/C25H36N4O2/c1-25(2,3)31-23(30)13-17-7-12-29(16-17)24-21-6-5-20(26)14-19(21)15-22(27-24)18-8-10-28(4)11-9-18/h5-6,14-15,17-18H,7-13,16,26H2,1-4H3/t17-/m0/s1 |
| InChIKey | NYXYWPQDIMHJLU-KRWDZBQOSA-N |
| XLogP | 4.18 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|