C14H15N5O — CID 118267662
(E)-2-cyano-3-[5-(propan-2-ylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide (PubChem CID 118267662) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-(propan-2-ylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[5-(propan-2-ylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 118267662 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | (E)-2-cyano-3-[5-(propan-2-ylamino)-1H-pyrrolo[2,3-b]pyridin-3-yl]prop-2-enamide |
| SMILES | CC(C)Nc1cnc2[nH]cc(/C=C(\C#N)C(N)=O)c2c1 |
| InChI | InChI=1S/C14H15N5O/c1-8(2)19-11-4-12-10(3-9(5-15)13(16)20)6-17-14(12)18-7-11/h3-4,6-8,19H,1-2H3,(H2,16,20)(H,17,18)/b9-3+ |
| InChIKey | GFEPWTLCUNQNLS-YCRREMRBSA-N |
| XLogP | 1.78 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|