C22H21Cl2NO6 — CID 118270600
4-[[(3aS,6aR)-2-[(3,5-dichlorophenyl)methoxycarbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]-2-hydroxybenzoic acid (PubChem CID 118270600) has the molecular formula C22H21Cl2NO6 and a molecular weight of 466.32 g/mol. Its IUPAC name is 4-[[(3aS,6aR)-2-[(3,5-dichlorophenyl)methoxycarbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]-2-hydroxybenzoic acid.
| Compound Name | 4-[[(3aS,6aR)-2-[(3,5-dichlorophenyl)methoxycarbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 118270600 |
| Molecular Formula | C22H21Cl2NO6 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 4-[[(3aS,6aR)-2-[(3,5-dichlorophenyl)methoxycarbonyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]oxy]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(OC2C[C@@H]3CN(C(=O)OCc4cc(Cl)cc(Cl)c4)C[C@@H]3C2)cc1O |
| InChI | InChI=1S/C22H21Cl2NO6/c23-15-3-12(4-16(24)7-15)11-30-22(29)25-9-13-5-18(6-14(13)10-25)31-17-1-2-19(21(27)28)20(26)8-17/h1-4,7-8,13-14,18,26H,5-6,9-11H2,(H,27,28)/t13-,14+,18? |
| InChIKey | YYFKCCPQWIXBKE-UUVAVEHKSA-N |
| XLogP | 4.82 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |