C14H17Cl3N2O2 — CID 155231497
(3,5-dichlorophenyl)methyl (3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate;hydrochloride (PubChem CID 155231497) has the molecular formula C14H17Cl3N2O2 and a molecular weight of 351.66 g/mol. Its IUPAC name is (3,5-dichlorophenyl)methyl (3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate;hydrochloride.
| Compound Name | (3,5-dichlorophenyl)methyl (3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 155231497 |
| Molecular Formula | C14H17Cl3N2O2 |
| Molecular Weight | 351.66 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | (3,5-dichlorophenyl)methyl (3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCc1cc(Cl)cc(Cl)c1)N1C[C@@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C14H16Cl2N2O2.ClH/c15-12-1-9(2-13(16)3-12)8-20-14(19)18-6-10-4-17-5-11(10)7-18;/h1-3,10-11,17H,4-8H2;1H/t10-,11-;/m0./s1 |
| InChIKey | GIIYAWWHYSPCED-ACMTZBLWSA-N |
| XLogP | 3.20 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.66 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |