C9H13Cl3N2O2 — CID 172546516
2,2,2-trichloroethyl (3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 172546516) has the molecular formula C9H13Cl3N2O2 and a molecular weight of 287.57 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 172546516 |
| Molecular Formula | C9H13Cl3N2O2 |
| Molecular Weight | 287.57 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 2,2,2-trichloroethyl (3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | O=C(OCC(Cl)(Cl)Cl)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C9H13Cl3N2O2/c10-9(11,12)5-16-8(15)14-3-6-1-13-2-7(6)4-14/h6-7,13H,1-5H2/t6-,7+ |
| InChIKey | QOECBVBLUAPLEC-KNVOCYPGSA-N |
| XLogP | 1.64 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.57 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|